C9H10F3NO2 — CID 77128126
4-(1-amino-2,2,2-trifluoroethyl)-2-methoxyphenol (PubChem CID 77128126) has the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. Its IUPAC name is 4-(1-amino-2,2,2-trifluoroethyl)-2-methoxyphenol.
| Compound Name | 4-(1-amino-2,2,2-trifluoroethyl)-2-methoxyphenol |
|---|---|
| PubChem CID | 77128126 |
| Molecular Formula | C9H10F3NO2 |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 4-(1-amino-2,2,2-trifluoroethyl)-2-methoxyphenol |
| SMILES | COc1cc(C(N)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C9H10F3NO2/c1-15-7-4-5(2-3-6(7)14)8(13)9(10,11)12/h2-4,8,14H,13H2,1H3 |
| InChIKey | CZOFZBZMAKCVKN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |