C12H17F2NO3 — CID 171312849
(1S)-3,3-difluoro-1-(3,4,5-trimethoxyphenyl)propan-1-amine (PubChem CID 171312849) has the molecular formula C12H17F2NO3 and a molecular weight of 261.27 g/mol. Its IUPAC name is (1S)-3,3-difluoro-1-(3,4,5-trimethoxyphenyl)propan-1-amine.
| Compound Name | (1S)-3,3-difluoro-1-(3,4,5-trimethoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 171312849 |
| Molecular Formula | C12H17F2NO3 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | (1S)-3,3-difluoro-1-(3,4,5-trimethoxyphenyl)propan-1-amine |
| SMILES | COc1cc([C@@H](N)CC(F)F)cc(OC)c1OC |
| InChI | InChI=1S/C12H17F2NO3/c1-16-9-4-7(8(15)6-11(13)14)5-10(17-2)12(9)18-3/h4-5,8,11H,6,15H2,1-3H3/t8-/m0/s1 |
| InChIKey | PANZOJPYDDQSHS-QMMMGPOBSA-N |
| XLogP | 2.37 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |