C10H12BrF2NO — CID 171313051
(1S)-1-(3-bromo-4-methoxyphenyl)-3,3-difluoropropan-1-amine (PubChem CID 171313051) has the molecular formula C10H12BrF2NO and a molecular weight of 280.11 g/mol. Its IUPAC name is (1S)-1-(3-bromo-4-methoxyphenyl)-3,3-difluoropropan-1-amine.
| Compound Name | (1S)-1-(3-bromo-4-methoxyphenyl)-3,3-difluoropropan-1-amine |
|---|---|
| PubChem CID | 171313051 |
| Molecular Formula | C10H12BrF2NO |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | (1S)-1-(3-bromo-4-methoxyphenyl)-3,3-difluoropropan-1-amine |
| SMILES | COc1ccc([C@@H](N)CC(F)F)cc1Br |
| InChI | InChI=1S/C10H12BrF2NO/c1-15-9-3-2-6(4-7(9)11)8(14)5-10(12)13/h2-4,8,10H,5,14H2,1H3/t8-/m0/s1 |
| InChIKey | UBEUAHNFUVJDRG-QMMMGPOBSA-N |
| XLogP | 3.11 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |