C10H12F2N2O4 — CID 171313762
4-[(1R)-1-amino-3,3-difluoropropyl]-2-methoxy-6-nitrophenol (PubChem CID 171313762) has the molecular formula C10H12F2N2O4 and a molecular weight of 262.21 g/mol. Its IUPAC name is 4-[(1R)-1-amino-3,3-difluoropropyl]-2-methoxy-6-nitrophenol.
| Compound Name | 4-[(1R)-1-amino-3,3-difluoropropyl]-2-methoxy-6-nitrophenol |
|---|---|
| PubChem CID | 171313762 |
| Molecular Formula | C10H12F2N2O4 |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 4-[(1R)-1-amino-3,3-difluoropropyl]-2-methoxy-6-nitrophenol |
| SMILES | COc1cc([C@H](N)CC(F)F)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C10H12F2N2O4/c1-18-8-3-5(6(13)4-9(11)12)2-7(10(8)15)14(16)17/h2-3,6,9,15H,4,13H2,1H3/t6-/m1/s1 |
| InChIKey | XFXMKJWZWLKMET-ZCFIWIBFSA-N |
| XLogP | 1.96 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|