C11H14N2O6 — CID 171249089
methyl (3R)-3-amino-3-(4-hydroxy-3-methoxy-5-nitrophenyl)propanoate (PubChem CID 171249089) has the molecular formula C11H14N2O6 and a molecular weight of 270.24 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(4-hydroxy-3-methoxy-5-nitrophenyl)propanoate.
| Compound Name | methyl (3R)-3-amino-3-(4-hydroxy-3-methoxy-5-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 171249089 |
| Molecular Formula | C11H14N2O6 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | methyl (3R)-3-amino-3-(4-hydroxy-3-methoxy-5-nitrophenyl)propanoate |
| SMILES | COC(=O)C[C@@H](N)c1cc(OC)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H14N2O6/c1-18-9-4-6(7(12)5-10(14)19-2)3-8(11(9)15)13(16)17/h3-4,7,15H,5,12H2,1-2H3/t7-/m1/s1 |
| InChIKey | JHRAPTYTECEKHY-SSDOTTSWSA-N |
| XLogP | 0.87 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|