C11H14N2O4 — CID 171227659
4-[(1S)-1-aminobut-3-enyl]-2-methoxy-6-nitrophenol (PubChem CID 171227659) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 4-[(1S)-1-aminobut-3-enyl]-2-methoxy-6-nitrophenol.
| Compound Name | 4-[(1S)-1-aminobut-3-enyl]-2-methoxy-6-nitrophenol |
|---|---|
| PubChem CID | 171227659 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 4-[(1S)-1-aminobut-3-enyl]-2-methoxy-6-nitrophenol |
| SMILES | C=CC[C@H](N)c1cc(OC)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H14N2O4/c1-3-4-8(12)7-5-9(13(15)16)11(14)10(6-7)17-2/h3,5-6,8,14H,1,4,12H2,2H3/t8-/m0/s1 |
| InChIKey | YQIJYWJINUCIOV-QMMMGPOBSA-N |
| XLogP | 1.88 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|