C12H15FN2O6 — CID 171242381
ethyl (3R)-3-amino-2-fluoro-3-(4-hydroxy-3-methoxy-5-nitrophenyl)propanoate (PubChem CID 171242381) has the molecular formula C12H15FN2O6 and a molecular weight of 302.26 g/mol. Its IUPAC name is ethyl (3R)-3-amino-2-fluoro-3-(4-hydroxy-3-methoxy-5-nitrophenyl)propanoate.
| Compound Name | ethyl (3R)-3-amino-2-fluoro-3-(4-hydroxy-3-methoxy-5-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 171242381 |
| Molecular Formula | C12H15FN2O6 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | ethyl (3R)-3-amino-2-fluoro-3-(4-hydroxy-3-methoxy-5-nitrophenyl)propanoate |
| SMILES | CCOC(=O)C(F)[C@H](N)c1cc(OC)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H15FN2O6/c1-3-21-12(17)9(13)10(14)6-4-7(15(18)19)11(16)8(5-6)20-2/h4-5,9-10,16H,3,14H2,1-2H3/t9?,10-/m1/s1 |
| InChIKey | YBSXNJLOXISPSI-QVDQXJPCSA-N |
| XLogP | 1.21 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|