C9H13N3O4 — CID 66518103
4-[(1S)-1,2-diaminoethyl]-2-methoxy-6-nitrophenol (PubChem CID 66518103) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is 4-[(1S)-1,2-diaminoethyl]-2-methoxy-6-nitrophenol.
| Compound Name | 4-[(1S)-1,2-diaminoethyl]-2-methoxy-6-nitrophenol |
|---|---|
| PubChem CID | 66518103 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 4-[(1S)-1,2-diaminoethyl]-2-methoxy-6-nitrophenol |
| SMILES | COc1cc([C@H](N)CN)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C9H13N3O4/c1-16-8-3-5(6(11)4-10)2-7(9(8)13)12(14)15/h2-3,6,13H,4,10-11H2,1H3/t6-/m1/s1 |
| InChIKey | WZIGZLJTLRVURI-ZCFIWIBFSA-N |
| XLogP | 0.27 |
| TPSA | 124.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|