C10H14ClFN2O4 — CID 171208094
4-[(1R)-1-amino-3-fluoropropyl]-2-methoxy-6-nitrophenol;hydrochloride (PubChem CID 171208094) has the molecular formula C10H14ClFN2O4 and a molecular weight of 280.68 g/mol. Its IUPAC name is 4-[(1R)-1-amino-3-fluoropropyl]-2-methoxy-6-nitrophenol;hydrochloride.
| Compound Name | 4-[(1R)-1-amino-3-fluoropropyl]-2-methoxy-6-nitrophenol;hydrochloride |
|---|---|
| PubChem CID | 171208094 |
| Molecular Formula | C10H14ClFN2O4 |
| Molecular Weight | 280.68 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 4-[(1R)-1-amino-3-fluoropropyl]-2-methoxy-6-nitrophenol;hydrochloride |
| SMILES | COc1cc([C@H](N)CCF)cc([N+](=O)[O-])c1O.Cl |
| InChI | InChI=1S/C10H13FN2O4.ClH/c1-17-9-5-6(7(12)2-3-11)4-8(10(9)14)13(15)16;/h4-5,7,14H,2-3,12H2,1H3;1H/t7-;/m1./s1 |
| InChIKey | XNRYJEHJDFRFAD-OGFXRTJISA-N |
| XLogP | 2.09 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.68 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|