C10H12F2N2O5 — CID 171249105
4-[(1S)-1-amino-2,2-difluoro-3-hydroxypropyl]-2-methoxy-6-nitrophenol (PubChem CID 171249105) has the molecular formula C10H12F2N2O5 and a molecular weight of 278.21 g/mol. Its IUPAC name is 4-[(1S)-1-amino-2,2-difluoro-3-hydroxypropyl]-2-methoxy-6-nitrophenol.
| Compound Name | 4-[(1S)-1-amino-2,2-difluoro-3-hydroxypropyl]-2-methoxy-6-nitrophenol |
|---|---|
| PubChem CID | 171249105 |
| Molecular Formula | C10H12F2N2O5 |
| Molecular Weight | 278.21 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 4-[(1S)-1-amino-2,2-difluoro-3-hydroxypropyl]-2-methoxy-6-nitrophenol |
| SMILES | COc1cc([C@H](N)C(F)(F)CO)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C10H12F2N2O5/c1-19-7-3-5(9(13)10(11,12)4-15)2-6(8(7)16)14(17)18/h2-3,9,15-16H,4,13H2,1H3/t9-/m0/s1 |
| InChIKey | ZKANZTQDRJKVPZ-VIFPVBQESA-N |
| XLogP | 0.94 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.21 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|