C14H20ClF2N3O5 — CID 171190134
4-[(1S)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-2-methoxy-6-nitrophenol;hydrochloride (PubChem CID 171190134) has the molecular formula C14H20ClF2N3O5 and a molecular weight of 383.78 g/mol. Its IUPAC name is 4-[(1S)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-2-methoxy-6-nitrophenol;hydrochloride.
| Compound Name | 4-[(1S)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-2-methoxy-6-nitrophenol;hydrochloride |
|---|---|
| PubChem CID | 171190134 |
| Molecular Formula | C14H20ClF2N3O5 |
| Molecular Weight | 383.78 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 4-[(1S)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-2-methoxy-6-nitrophenol;hydrochloride |
| SMILES | COc1cc([C@H](N2CCNCC2)C(F)(F)CO)cc([N+](=O)[O-])c1O.Cl |
| InChI | InChI=1S/C14H19F2N3O5.ClH/c1-24-11-7-9(6-10(12(11)21)19(22)23)13(14(15,16)8-20)18-4-2-17-3-5-18;/h6-7,13,17,20-21H,2-5,8H2,1H3;1H/t13-;/m0./s1 |
| InChIKey | QQCKFHWPWKRBIO-ZOWNYOTGSA-N |
| XLogP | 1.30 |
| TPSA | 108.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.78 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|