C14H20Cl2F3N3O4 — CID 171303811
2-methoxy-6-nitro-4-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol;dihydrochloride (PubChem CID 171303811) has the molecular formula C14H20Cl2F3N3O4 and a molecular weight of 422.23 g/mol. Its IUPAC name is 2-methoxy-6-nitro-4-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol;dihydrochloride.
| Compound Name | 2-methoxy-6-nitro-4-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171303811 |
| Molecular Formula | C14H20Cl2F3N3O4 |
| Molecular Weight | 422.23 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 2-methoxy-6-nitro-4-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol;dihydrochloride |
| SMILES | COc1cc([C@@H](CC(F)(F)F)N2CCNCC2)cc([N+](=O)[O-])c1O.Cl.Cl |
| InChI | InChI=1S/C14H18F3N3O4.2ClH/c1-24-12-7-9(6-10(13(12)21)20(22)23)11(8-14(15,16)17)19-4-2-18-3-5-19;;/h6-7,11,18,21H,2-5,8H2,1H3;2*1H/t11-;;/m1../s1 |
| InChIKey | VNPGSVWPMUSDFH-NVJADKKVSA-N |
| XLogP | 3.05 |
| TPSA | 87.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.23 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|