C8H12ClN3O4 — CID 171219875
5-[(1R)-1,2-diaminoethyl]-3-nitrobenzene-1,2-diol;hydrochloride (PubChem CID 171219875) has the molecular formula C8H12ClN3O4 and a molecular weight of 249.65 g/mol. Its IUPAC name is 5-[(1R)-1,2-diaminoethyl]-3-nitrobenzene-1,2-diol;hydrochloride.
| Compound Name | 5-[(1R)-1,2-diaminoethyl]-3-nitrobenzene-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 171219875 |
| Molecular Formula | C8H12ClN3O4 |
| Molecular Weight | 249.65 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 5-[(1R)-1,2-diaminoethyl]-3-nitrobenzene-1,2-diol;hydrochloride |
| SMILES | Cl.NC[C@H](N)c1cc(O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H11N3O4.ClH/c9-3-5(10)4-1-6(11(14)15)8(13)7(12)2-4;/h1-2,5,12-13H,3,9-10H2;1H/t5-;/m0./s1 |
| InChIKey | DXCPCDQIQHEKMS-JEDNCBNOSA-N |
| XLogP | 0.39 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.65 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|