C11H17ClN2O4 — CID 171246414
5-[(1R)-1-amino-2,2-dimethylpropyl]-3-nitrobenzene-1,2-diol;hydrochloride (PubChem CID 171246414) has the molecular formula C11H17ClN2O4 and a molecular weight of 276.72 g/mol. Its IUPAC name is 5-[(1R)-1-amino-2,2-dimethylpropyl]-3-nitrobenzene-1,2-diol;hydrochloride.
| Compound Name | 5-[(1R)-1-amino-2,2-dimethylpropyl]-3-nitrobenzene-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 171246414 |
| Molecular Formula | C11H17ClN2O4 |
| Molecular Weight | 276.72 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 5-[(1R)-1-amino-2,2-dimethylpropyl]-3-nitrobenzene-1,2-diol;hydrochloride |
| SMILES | CC(C)(C)[C@@H](N)c1cc(O)c(O)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C11H16N2O4.ClH/c1-11(2,3)10(12)6-4-7(13(16)17)9(15)8(14)5-6;/h4-5,10,14-15H,12H2,1-3H3;1H/t10-;/m0./s1 |
| InChIKey | OUSPBMSSCPBFEC-PPHPATTJSA-N |
| XLogP | 2.47 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.72 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|