C12H16N2O5 — CID 171246405
5-[(R)-amino(oxan-4-yl)methyl]-3-nitrobenzene-1,2-diol (PubChem CID 171246405) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 5-[(R)-amino(oxan-4-yl)methyl]-3-nitrobenzene-1,2-diol.
| Compound Name | 5-[(R)-amino(oxan-4-yl)methyl]-3-nitrobenzene-1,2-diol |
|---|---|
| PubChem CID | 171246405 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 5-[(R)-amino(oxan-4-yl)methyl]-3-nitrobenzene-1,2-diol |
| SMILES | N[C@@H](c1cc(O)c(O)c([N+](=O)[O-])c1)C1CCOCC1 |
| InChI | InChI=1S/C12H16N2O5/c13-11(7-1-3-19-4-2-7)8-5-9(14(17)18)12(16)10(15)6-8/h5-7,11,15-16H,1-4,13H2/t11-/m1/s1 |
| InChIKey | OJVGCGIJAWZHTM-LLVKDONJSA-N |
| XLogP | 1.43 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|