C12H18ClNO3 — CID 171246230
5-[(R)-amino(oxan-4-yl)methyl]benzene-1,3-diol;hydrochloride (PubChem CID 171246230) has the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. Its IUPAC name is 5-[(R)-amino(oxan-4-yl)methyl]benzene-1,3-diol;hydrochloride.
| Compound Name | 5-[(R)-amino(oxan-4-yl)methyl]benzene-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 171246230 |
| Molecular Formula | C12H18ClNO3 |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 5-[(R)-amino(oxan-4-yl)methyl]benzene-1,3-diol;hydrochloride |
| SMILES | Cl.N[C@@H](c1cc(O)cc(O)c1)C1CCOCC1 |
| InChI | InChI=1S/C12H17NO3.ClH/c13-12(8-1-3-16-4-2-8)9-5-10(14)7-11(15)6-9;/h5-8,12,14-15H,1-4,13H2;1H/t12-;/m1./s1 |
| InChIKey | TXJGOEVDRKRLSL-UTONKHPSSA-N |
| XLogP | 1.95 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |