C12H15Cl2NO — CID 131424758
(R)-(3,5-dichlorophenyl)-(oxan-4-yl)methanamine (PubChem CID 131424758) has the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. Its IUPAC name is (R)-(3,5-dichlorophenyl)-(oxan-4-yl)methanamine.
| Compound Name | (R)-(3,5-dichlorophenyl)-(oxan-4-yl)methanamine |
|---|---|
| PubChem CID | 131424758 |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | (R)-(3,5-dichlorophenyl)-(oxan-4-yl)methanamine |
| SMILES | N[C@@H](c1cc(Cl)cc(Cl)c1)C1CCOCC1 |
| InChI | InChI=1S/C12H15Cl2NO/c13-10-5-9(6-11(14)7-10)12(15)8-1-3-16-4-2-8/h5-8,12H,1-4,15H2/t12-/m1/s1 |
| InChIKey | HEDHXTIORKQNGK-GFCCVEGCSA-N |
| XLogP | 3.42 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |