C9H12N2O5 — CID 171200390
5-[(1R)-1-amino-3-hydroxypropyl]-3-nitrobenzene-1,2-diol (PubChem CID 171200390) has the molecular formula C9H12N2O5 and a molecular weight of 228.20 g/mol. Its IUPAC name is 5-[(1R)-1-amino-3-hydroxypropyl]-3-nitrobenzene-1,2-diol.
| Compound Name | 5-[(1R)-1-amino-3-hydroxypropyl]-3-nitrobenzene-1,2-diol |
|---|---|
| PubChem CID | 171200390 |
| Molecular Formula | C9H12N2O5 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 5-[(1R)-1-amino-3-hydroxypropyl]-3-nitrobenzene-1,2-diol |
| SMILES | N[C@H](CCO)c1cc(O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H12N2O5/c10-6(1-2-12)5-3-7(11(15)16)9(14)8(13)4-5/h3-4,6,12-14H,1-2,10H2/t6-/m1/s1 |
| InChIKey | FLEXWZXGYRNCAU-ZCFIWIBFSA-N |
| XLogP | 0.39 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|