C12H18N2O5 — CID 171261227
5-[(1R,2S)-1-amino-2-hydroxy-3-methylpentyl]-3-nitrobenzene-1,2-diol (PubChem CID 171261227) has the molecular formula C12H18N2O5 and a molecular weight of 270.29 g/mol. Its IUPAC name is 5-[(1R,2S)-1-amino-2-hydroxy-3-methylpentyl]-3-nitrobenzene-1,2-diol.
| Compound Name | 5-[(1R,2S)-1-amino-2-hydroxy-3-methylpentyl]-3-nitrobenzene-1,2-diol |
|---|---|
| PubChem CID | 171261227 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 5-[(1R,2S)-1-amino-2-hydroxy-3-methylpentyl]-3-nitrobenzene-1,2-diol |
| SMILES | CCC(C)[C@H](O)[C@H](N)c1cc(O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H18N2O5/c1-3-6(2)11(16)10(13)7-4-8(14(18)19)12(17)9(15)5-7/h4-6,10-11,15-17H,3,13H2,1-2H3/t6?,10-,11+/m1/s1 |
| InChIKey | GPGZZYKHNRZRCL-XNHZYUOPSA-N |
| XLogP | 1.41 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|