C11H17ClN2O5 — CID 171246410
5-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-3-nitrobenzene-1,2-diol;hydrochloride (PubChem CID 171246410) has the molecular formula C11H17ClN2O5 and a molecular weight of 292.72 g/mol. Its IUPAC name is 5-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-3-nitrobenzene-1,2-diol;hydrochloride.
| Compound Name | 5-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-3-nitrobenzene-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 171246410 |
| Molecular Formula | C11H17ClN2O5 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 5-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-3-nitrobenzene-1,2-diol;hydrochloride |
| SMILES | CC(C)(CO)[C@@H](N)c1cc(O)c(O)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C11H16N2O5.ClH/c1-11(2,5-14)10(12)6-3-7(13(17)18)9(16)8(15)4-6;/h3-4,10,14-16H,5,12H2,1-2H3;1H/t10-;/m0./s1 |
| InChIKey | KYXBPCYULWTPFJ-PPHPATTJSA-N |
| XLogP | 1.45 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|