C11H16ClFN2O3 — CID 171248708
(3S)-3-amino-3-(4-fluoro-3-nitrophenyl)-2,2-dimethylpropan-1-ol;hydrochloride (PubChem CID 171248708) has the molecular formula C11H16ClFN2O3 and a molecular weight of 278.71 g/mol. Its IUPAC name is (3S)-3-amino-3-(4-fluoro-3-nitrophenyl)-2,2-dimethylpropan-1-ol;hydrochloride.
| Compound Name | (3S)-3-amino-3-(4-fluoro-3-nitrophenyl)-2,2-dimethylpropan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171248708 |
| Molecular Formula | C11H16ClFN2O3 |
| Molecular Weight | 278.71 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | (3S)-3-amino-3-(4-fluoro-3-nitrophenyl)-2,2-dimethylpropan-1-ol;hydrochloride |
| SMILES | CC(C)(CO)[C@@H](N)c1ccc(F)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C11H15FN2O3.ClH/c1-11(2,6-15)10(13)7-3-4-8(12)9(5-7)14(16)17;/h3-5,10,15H,6,13H2,1-2H3;1H/t10-;/m0./s1 |
| InChIKey | KUUOBAPUIFZUQD-PPHPATTJSA-N |
| XLogP | 2.17 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.71 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|