C12H18BrClN2O4 — CID 171264984
2-[(1R,2S)-1-amino-2-hydroxy-3-methylpentyl]-6-bromo-4-nitrophenol;hydrochloride (PubChem CID 171264984) has the molecular formula C12H18BrClN2O4 and a molecular weight of 369.64 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-hydroxy-3-methylpentyl]-6-bromo-4-nitrophenol;hydrochloride.
| Compound Name | 2-[(1R,2S)-1-amino-2-hydroxy-3-methylpentyl]-6-bromo-4-nitrophenol;hydrochloride |
|---|---|
| PubChem CID | 171264984 |
| Molecular Formula | C12H18BrClN2O4 |
| Molecular Weight | 369.64 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-hydroxy-3-methylpentyl]-6-bromo-4-nitrophenol;hydrochloride |
| SMILES | CCC(C)[C@H](O)[C@H](N)c1cc([N+](=O)[O-])cc(Br)c1O.Cl |
| InChI | InChI=1S/C12H17BrN2O4.ClH/c1-3-6(2)11(16)10(14)8-4-7(15(18)19)5-9(13)12(8)17;/h4-6,10-11,16-17H,3,14H2,1-2H3;1H/t6?,10-,11+;/m1./s1 |
| InChIKey | GZMBHPSASKHPMK-FVATXLHGSA-N |
| XLogP | 2.89 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.64 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|