C12H16BrClN2O5 — CID 171244060
methyl (3R)-3-amino-3-(3-bromo-2-hydroxy-5-nitrophenyl)-2,2-dimethylpropanoate;hydrochloride (PubChem CID 171244060) has the molecular formula C12H16BrClN2O5 and a molecular weight of 383.63 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(3-bromo-2-hydroxy-5-nitrophenyl)-2,2-dimethylpropanoate;hydrochloride.
| Compound Name | methyl (3R)-3-amino-3-(3-bromo-2-hydroxy-5-nitrophenyl)-2,2-dimethylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 171244060 |
| Molecular Formula | C12H16BrClN2O5 |
| Molecular Weight | 383.63 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | methyl (3R)-3-amino-3-(3-bromo-2-hydroxy-5-nitrophenyl)-2,2-dimethylpropanoate;hydrochloride |
| SMILES | COC(=O)C(C)(C)[C@H](N)c1cc([N+](=O)[O-])cc(Br)c1O.Cl |
| InChI | InChI=1S/C12H15BrN2O5.ClH/c1-12(2,11(17)20-3)10(14)7-4-6(15(18)19)5-8(13)9(7)16;/h4-5,10,16H,14H2,1-3H3;1H/t10-;/m1./s1 |
| InChIKey | FDSMDCNFOQDGTG-HNCPQSOCSA-N |
| XLogP | 2.68 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.63 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|