C12H16BrCl2NO3 — CID 171253262
methyl (3R)-3-amino-3-(5-bromo-3-chloro-2-hydroxyphenyl)-2,2-dimethylpropanoate;hydrochloride (PubChem CID 171253262) has the molecular formula C12H16BrCl2NO3 and a molecular weight of 373.07 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(5-bromo-3-chloro-2-hydroxyphenyl)-2,2-dimethylpropanoate;hydrochloride.
| Compound Name | methyl (3R)-3-amino-3-(5-bromo-3-chloro-2-hydroxyphenyl)-2,2-dimethylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 171253262 |
| Molecular Formula | C12H16BrCl2NO3 |
| Molecular Weight | 373.07 g/mol |
| Exact Mass | 370.97 |
| IUPAC Name | methyl (3R)-3-amino-3-(5-bromo-3-chloro-2-hydroxyphenyl)-2,2-dimethylpropanoate;hydrochloride |
| SMILES | COC(=O)C(C)(C)[C@H](N)c1cc(Br)cc(Cl)c1O.Cl |
| InChI | InChI=1S/C12H15BrClNO3.ClH/c1-12(2,11(17)18-3)10(15)7-4-6(13)5-8(14)9(7)16;/h4-5,10,16H,15H2,1-3H3;1H/t10-;/m1./s1 |
| InChIKey | SOQCWTDMOPFSTF-HNCPQSOCSA-N |
| XLogP | 3.43 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.07 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|