C13H16BrNO5 — CID 171258124
3-[(1S)-1-amino-3-methoxy-2,2-dimethyl-3-oxopropyl]-5-bromo-4-hydroxybenzoic acid (PubChem CID 171258124) has the molecular formula C13H16BrNO5 and a molecular weight of 346.18 g/mol. Its IUPAC name is 3-[(1S)-1-amino-3-methoxy-2,2-dimethyl-3-oxopropyl]-5-bromo-4-hydroxybenzoic acid.
| Compound Name | 3-[(1S)-1-amino-3-methoxy-2,2-dimethyl-3-oxopropyl]-5-bromo-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 171258124 |
| Molecular Formula | C13H16BrNO5 |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 3-[(1S)-1-amino-3-methoxy-2,2-dimethyl-3-oxopropyl]-5-bromo-4-hydroxybenzoic acid |
| SMILES | COC(=O)C(C)(C)[C@@H](N)c1cc(C(=O)O)cc(Br)c1O |
| InChI | InChI=1S/C13H16BrNO5/c1-13(2,12(19)20-3)10(15)7-4-6(11(17)18)5-8(14)9(7)16/h4-5,10,16H,15H2,1-3H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | DCRKHSZMMHPFQV-JTQLQIEISA-N |
| XLogP | 2.05 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|