C20H33NO3 — CID 171240283
methyl (3R)-3-amino-3-(3,5-ditert-butyl-2-hydroxyphenyl)-2,2-dimethylpropanoate (PubChem CID 171240283) has the molecular formula C20H33NO3 and a molecular weight of 335.49 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(3,5-ditert-butyl-2-hydroxyphenyl)-2,2-dimethylpropanoate.
| Compound Name | methyl (3R)-3-amino-3-(3,5-ditert-butyl-2-hydroxyphenyl)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 171240283 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | methyl (3R)-3-amino-3-(3,5-ditert-butyl-2-hydroxyphenyl)-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)[C@H](N)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C20H33NO3/c1-18(2,3)12-10-13(15(22)14(11-12)19(4,5)6)16(21)20(7,8)17(23)24-9/h10-11,16,22H,21H2,1-9H3/t16-/m1/s1 |
| InChIKey | VTGRYMPYYVNWBL-MRXNPFEDSA-N |
| XLogP | 4.19 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|