C19H34ClNO — CID 171247011
2-[(1R)-1-amino-2,2-dimethylpropyl]-4,6-ditert-butylphenol;hydrochloride (PubChem CID 171247011) has the molecular formula C19H34ClNO and a molecular weight of 327.94 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2-dimethylpropyl]-4,6-ditert-butylphenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-2,2-dimethylpropyl]-4,6-ditert-butylphenol;hydrochloride |
|---|---|
| PubChem CID | 171247011 |
| Molecular Formula | C19H34ClNO |
| Molecular Weight | 327.94 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | 2-[(1R)-1-amino-2,2-dimethylpropyl]-4,6-ditert-butylphenol;hydrochloride |
| SMILES | CC(C)(C)c1cc([C@H](N)C(C)(C)C)c(O)c(C(C)(C)C)c1.Cl |
| InChI | InChI=1S/C19H33NO.ClH/c1-17(2,3)12-10-13(16(20)19(7,8)9)15(21)14(11-12)18(4,5)6;/h10-11,16,21H,20H2,1-9H3;1H/t16-;/m0./s1 |
| InChIKey | KEKRNLOLMCHDLV-NTISSMGPSA-N |
| XLogP | 5.45 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.94 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|