C17H30ClNO2 — CID 170874618
2-(1-amino-3-hydroxypropyl)-4,6-ditert-butylphenol;hydrochloride (PubChem CID 170874618) has the molecular formula C17H30ClNO2 and a molecular weight of 315.89 g/mol. Its IUPAC name is 2-(1-amino-3-hydroxypropyl)-4,6-ditert-butylphenol;hydrochloride.
| Compound Name | 2-(1-amino-3-hydroxypropyl)-4,6-ditert-butylphenol;hydrochloride |
|---|---|
| PubChem CID | 170874618 |
| Molecular Formula | C17H30ClNO2 |
| Molecular Weight | 315.89 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 2-(1-amino-3-hydroxypropyl)-4,6-ditert-butylphenol;hydrochloride |
| SMILES | CC(C)(C)c1cc(C(N)CCO)c(O)c(C(C)(C)C)c1.Cl |
| InChI | InChI=1S/C17H29NO2.ClH/c1-16(2,3)11-9-12(14(18)7-8-19)15(20)13(10-11)17(4,5)6;/h9-10,14,19-20H,7-8,18H2,1-6H3;1H |
| InChIKey | WUQAMYUEPROKEN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.89 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|