C18H30ClNO — CID 171201914
2-[(R)-amino(cyclopropyl)methyl]-4,6-ditert-butylphenol;hydrochloride (PubChem CID 171201914) has the molecular formula C18H30ClNO and a molecular weight of 311.90 g/mol. Its IUPAC name is 2-[(R)-amino(cyclopropyl)methyl]-4,6-ditert-butylphenol;hydrochloride.
| Compound Name | 2-[(R)-amino(cyclopropyl)methyl]-4,6-ditert-butylphenol;hydrochloride |
|---|---|
| PubChem CID | 171201914 |
| Molecular Formula | C18H30ClNO |
| Molecular Weight | 311.90 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 2-[(R)-amino(cyclopropyl)methyl]-4,6-ditert-butylphenol;hydrochloride |
| SMILES | CC(C)(C)c1cc([C@H](N)C2CC2)c(O)c(C(C)(C)C)c1.Cl |
| InChI | InChI=1S/C18H29NO.ClH/c1-17(2,3)12-9-13(15(19)11-7-8-11)16(20)14(10-12)18(4,5)6;/h9-11,15,20H,7-8,19H2,1-6H3;1H/t15-;/m1./s1 |
| InChIKey | VMDMAXMQICAQBH-XFULWGLBSA-N |
| XLogP | 4.82 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.90 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|