C20H36ClNO — CID 171221472
2-[(1S)-1-amino-4-methylpentyl]-4,6-ditert-butylphenol;hydrochloride (PubChem CID 171221472) has the molecular formula C20H36ClNO and a molecular weight of 341.97 g/mol. Its IUPAC name is 2-[(1S)-1-amino-4-methylpentyl]-4,6-ditert-butylphenol;hydrochloride.
| Compound Name | 2-[(1S)-1-amino-4-methylpentyl]-4,6-ditert-butylphenol;hydrochloride |
|---|---|
| PubChem CID | 171221472 |
| Molecular Formula | C20H36ClNO |
| Molecular Weight | 341.97 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | 2-[(1S)-1-amino-4-methylpentyl]-4,6-ditert-butylphenol;hydrochloride |
| SMILES | CC(C)CC[C@H](N)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O.Cl |
| InChI | InChI=1S/C20H35NO.ClH/c1-13(2)9-10-17(21)15-11-14(19(3,4)5)12-16(18(15)22)20(6,7)8;/h11-13,17,22H,9-10,21H2,1-8H3;1H/t17-;/m0./s1 |
| InChIKey | LLCPSIOLCLWMSU-LMOVPXPDSA-N |
| XLogP | 5.84 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.97 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|