C16H27NO2 — CID 66515999
2-[(1S)-1-amino-2-hydroxyethyl]-4,6-ditert-butylphenol (PubChem CID 66515999) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2-hydroxyethyl]-4,6-ditert-butylphenol.
| Compound Name | 2-[(1S)-1-amino-2-hydroxyethyl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 66515999 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 2-[(1S)-1-amino-2-hydroxyethyl]-4,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc([C@H](N)CO)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C16H27NO2/c1-15(2,3)10-7-11(13(17)9-18)14(19)12(8-10)16(4,5)6/h7-8,13,18-19H,9,17H2,1-6H3/t13-/m1/s1 |
| InChIKey | ZVUKGEHMHKBGAA-CYBMUJFWSA-N |
| XLogP | 2.98 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|