C17H29NO2 — CID 171261580
2-[(1R,2S)-1-amino-2-hydroxypropyl]-4,6-ditert-butylphenol (PubChem CID 171261580) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-hydroxypropyl]-4,6-ditert-butylphenol.
| Compound Name | 2-[(1R,2S)-1-amino-2-hydroxypropyl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 171261580 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-hydroxypropyl]-4,6-ditert-butylphenol |
| SMILES | C[C@H](O)[C@H](N)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C17H29NO2/c1-10(19)14(18)12-8-11(16(2,3)4)9-13(15(12)20)17(5,6)7/h8-10,14,19-20H,18H2,1-7H3/t10-,14-/m0/s1 |
| InChIKey | LEYOVBCKOXWDSV-HZMBPMFUSA-N |
| XLogP | 3.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|