C64H90O4 — CID 102598730
2-[[4-[bis(3,5-ditert-butyl-2-hydroxyphenyl)methyl]phenyl]-(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4,6-ditert-butylphenol (PubChem CID 102598730) has the molecular formula C64H90O4 and a molecular weight of 923.42 g/mol. Its IUPAC name is 2-[[4-[bis(3,5-ditert-butyl-2-hydroxyphenyl)methyl]phenyl]-(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4,6-ditert-butylphenol.
| Compound Name | 2-[[4-[bis(3,5-ditert-butyl-2-hydroxyphenyl)methyl]phenyl]-(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 102598730 |
| Molecular Formula | C64H90O4 |
| Molecular Weight | 923.42 g/mol |
| Exact Mass | 922.68 |
| IUPAC Name | 2-[[4-[bis(3,5-ditert-butyl-2-hydroxyphenyl)methyl]phenyl]-(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(C(c2ccc(C(c3cc(C(C)(C)C)cc(C(C)(C)C)c3O)c3cc(C(C)(C)C)cc(C(C)(C)C)c3O)cc2)c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C64H90O4/c1-57(2,3)39-29-43(53(65)47(33-39)61(13,14)15)51(44-30-40(58(4,5)6)34-48(54(44)66)62(16,17)18)37-25-27-38(28-26-37)52(45-31-41(59(7,8)9)35-49(55(45)67)63(19,20)21)46-32-42(60(10,11)12)36-50(56(46)68)64(22,23)24/h25-36,51-52,65-68H,1-24H3 |
| InChIKey | QWLBFSGFYGVKOK-UHFFFAOYSA-N |
| XLogP | 17.25 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.42 |
| LogP ≤ 5 | 17.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|