C70H92O5 — CID 12057284
2-[[6-[bis(3,5-ditert-butyl-2-hydroxyphenyl)methyl]dibenzofuran-4-yl]-(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4,6-ditert-butylphenol (PubChem CID 12057284) has the molecular formula C70H92O5 and a molecular weight of 1013.50 g/mol. Its IUPAC name is 2-[[6-[bis(3,5-ditert-butyl-2-hydroxyphenyl)methyl]dibenzofuran-4-yl]-(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4,6-ditert-butylphenol.
| Compound Name | 2-[[6-[bis(3,5-ditert-butyl-2-hydroxyphenyl)methyl]dibenzofuran-4-yl]-(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 12057284 |
| Molecular Formula | C70H92O5 |
| Molecular Weight | 1013.50 g/mol |
| Exact Mass | 1012.69 |
| IUPAC Name | 2-[[6-[bis(3,5-ditert-butyl-2-hydroxyphenyl)methyl]dibenzofuran-4-yl]-(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(C(c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c2cccc3c2oc2c(C(c4cc(C(C)(C)C)cc(C(C)(C)C)c4O)c4cc(C(C)(C)C)cc(C(C)(C)C)c4O)cccc23)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C70H92O5/c1-63(2,3)39-31-47(57(71)51(35-39)67(13,14)15)55(48-32-40(64(4,5)6)36-52(58(48)72)68(16,17)18)45-29-25-27-43-44-28-26-30-46(62(44)75-61(43)45)56(49-33-41(65(7,8)9)37-53(59(49)73)69(19,20)21)50-34-42(66(10,11)12)38-54(60(50)74)70(22,23)24/h25-38,55-56,71-74H,1-24H3 |
| InChIKey | QUTVZYIHMQHGRB-UHFFFAOYSA-N |
| XLogP | 19.15 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1013.50 |
| LogP ≤ 5 | 19.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|