C34H60N2O2 — CID 174939437
bis(2,4-ditert-butyl-6-propan-2-ylphenol);hydrazine (PubChem CID 174939437) has the molecular formula C34H60N2O2 and a molecular weight of 528.87 g/mol. Its IUPAC name is bis(2,4-ditert-butyl-6-propan-2-ylphenol);hydrazine.
| Compound Name | bis(2,4-ditert-butyl-6-propan-2-ylphenol);hydrazine |
|---|---|
| PubChem CID | 174939437 |
| Molecular Formula | C34H60N2O2 |
| Molecular Weight | 528.87 g/mol |
| Exact Mass | 528.47 |
| IUPAC Name | bis(2,4-ditert-butyl-6-propan-2-ylphenol);hydrazine |
| SMILES | CC(C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O.CC(C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O.NN |
| InChI | InChI=1S/2C17H28O.H4N2/c2*1-11(2)13-9-12(16(3,4)5)10-14(15(13)18)17(6,7)8;1-2/h2*9-11,18H,1-8H3;1-2H2 |
| InChIKey | GPONTPKPIMCFKB-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.87 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|