C16H26ClF2NO — CID 171247002
2-[(1S)-1-amino-2,2-difluoroethyl]-4,6-ditert-butylphenol;hydrochloride (PubChem CID 171247002) has the molecular formula C16H26ClF2NO and a molecular weight of 321.84 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2,2-difluoroethyl]-4,6-ditert-butylphenol;hydrochloride.
| Compound Name | 2-[(1S)-1-amino-2,2-difluoroethyl]-4,6-ditert-butylphenol;hydrochloride |
|---|---|
| PubChem CID | 171247002 |
| Molecular Formula | C16H26ClF2NO |
| Molecular Weight | 321.84 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-[(1S)-1-amino-2,2-difluoroethyl]-4,6-ditert-butylphenol;hydrochloride |
| SMILES | CC(C)(C)c1cc([C@H](N)C(F)F)c(O)c(C(C)(C)C)c1.Cl |
| InChI | InChI=1S/C16H25F2NO.ClH/c1-15(2,3)9-7-10(12(19)14(17)18)13(20)11(8-9)16(4,5)6;/h7-8,12,14,20H,19H2,1-6H3;1H/t12-;/m0./s1 |
| InChIKey | FKTXUELFOQFBIR-YDALLXLXSA-N |
| XLogP | 4.67 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.84 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|