C17H27ClN2O — CID 171259898
(3S)-3-amino-3-(3,5-ditert-butyl-2-hydroxyphenyl)propanenitrile;hydrochloride (PubChem CID 171259898) has the molecular formula C17H27ClN2O and a molecular weight of 310.87 g/mol. Its IUPAC name is (3S)-3-amino-3-(3,5-ditert-butyl-2-hydroxyphenyl)propanenitrile;hydrochloride.
| Compound Name | (3S)-3-amino-3-(3,5-ditert-butyl-2-hydroxyphenyl)propanenitrile;hydrochloride |
|---|---|
| PubChem CID | 171259898 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (3S)-3-amino-3-(3,5-ditert-butyl-2-hydroxyphenyl)propanenitrile;hydrochloride |
| SMILES | CC(C)(C)c1cc([C@@H](N)CC#N)c(O)c(C(C)(C)C)c1.Cl |
| InChI | InChI=1S/C17H26N2O.ClH/c1-16(2,3)11-9-12(14(19)7-8-18)15(20)13(10-11)17(4,5)6;/h9-10,14,20H,7,19H2,1-6H3;1H/t14-;/m0./s1 |
| InChIKey | ZLCWQTFZRWCQLQ-UQKRIMTDSA-N |
| XLogP | 4.32 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|