C21H35Cl2N3O — CID 171306669
(3R)-3-(3,5-ditert-butyl-2-hydroxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride (PubChem CID 171306669) has the molecular formula C21H35Cl2N3O and a molecular weight of 416.44 g/mol. Its IUPAC name is (3R)-3-(3,5-ditert-butyl-2-hydroxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride.
| Compound Name | (3R)-3-(3,5-ditert-butyl-2-hydroxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
|---|---|
| PubChem CID | 171306669 |
| Molecular Formula | C21H35Cl2N3O |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | (3R)-3-(3,5-ditert-butyl-2-hydroxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
| SMILES | CC(C)(C)c1cc([C@@H](CC#N)N2CCNCC2)c(O)c(C(C)(C)C)c1.Cl.Cl |
| InChI | InChI=1S/C21H33N3O.2ClH/c1-20(2,3)15-13-16(19(25)17(14-15)21(4,5)6)18(7-8-22)24-11-9-23-10-12-24;;/h13-14,18,23,25H,7,9-12H2,1-6H3;2*1H/t18-;;/m1../s1 |
| InChIKey | CVXSQSGATBXGQU-JPKZNVRTSA-N |
| XLogP | 4.69 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|