C22H36N2O — CID 171275319
2,4-ditert-butyl-6-[(1S)-1-piperazin-1-ylbut-3-enyl]phenol (PubChem CID 171275319) has the molecular formula C22H36N2O and a molecular weight of 344.54 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[(1S)-1-piperazin-1-ylbut-3-enyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[(1S)-1-piperazin-1-ylbut-3-enyl]phenol |
|---|---|
| PubChem CID | 171275319 |
| Molecular Formula | C22H36N2O |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.28 |
| IUPAC Name | 2,4-ditert-butyl-6-[(1S)-1-piperazin-1-ylbut-3-enyl]phenol |
| SMILES | C=CC[C@@H](c1cc(C(C)(C)C)cc(C(C)(C)C)c1O)N1CCNCC1 |
| InChI | InChI=1S/C22H36N2O/c1-8-9-19(24-12-10-23-11-13-24)17-14-16(21(2,3)4)15-18(20(17)25)22(5,6)7/h8,14-15,19,23,25H,1,9-13H2,2-7H3/t19-/m0/s1 |
| InChIKey | CCLCAWMNWCHNGA-IBGZPJMESA-N |
| XLogP | 4.51 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|