C24H42N2O — CID 171309829
2,6-ditert-butyl-4-[(1S)-4-methyl-1-piperazin-1-ylpentyl]phenol (PubChem CID 171309829) has the molecular formula C24H42N2O and a molecular weight of 374.61 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(1S)-4-methyl-1-piperazin-1-ylpentyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(1S)-4-methyl-1-piperazin-1-ylpentyl]phenol |
|---|---|
| PubChem CID | 171309829 |
| Molecular Formula | C24H42N2O |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.33 |
| IUPAC Name | 2,6-ditert-butyl-4-[(1S)-4-methyl-1-piperazin-1-ylpentyl]phenol |
| SMILES | CC(C)CC[C@@H](c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)N1CCNCC1 |
| InChI | InChI=1S/C24H42N2O/c1-17(2)9-10-21(26-13-11-25-12-14-26)18-15-19(23(3,4)5)22(27)20(16-18)24(6,7)8/h15-17,21,25,27H,9-14H2,1-8H3/t21-/m0/s1 |
| InChIKey | LWBCJRBNOLNPSM-NRFANRHFSA-N |
| XLogP | 5.37 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |