C16H24Br2N2O — CID 171310693
2,6-dibromo-4-[(1R)-4-methyl-1-piperazin-1-ylpentyl]phenol (PubChem CID 171310693) has the molecular formula C16H24Br2N2O and a molecular weight of 420.19 g/mol. Its IUPAC name is 2,6-dibromo-4-[(1R)-4-methyl-1-piperazin-1-ylpentyl]phenol.
| Compound Name | 2,6-dibromo-4-[(1R)-4-methyl-1-piperazin-1-ylpentyl]phenol |
|---|---|
| PubChem CID | 171310693 |
| Molecular Formula | C16H24Br2N2O |
| Molecular Weight | 420.19 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | 2,6-dibromo-4-[(1R)-4-methyl-1-piperazin-1-ylpentyl]phenol |
| SMILES | CC(C)CC[C@H](c1cc(Br)c(O)c(Br)c1)N1CCNCC1 |
| InChI | InChI=1S/C16H24Br2N2O/c1-11(2)3-4-15(20-7-5-19-6-8-20)12-9-13(17)16(21)14(18)10-12/h9-11,15,19,21H,3-8H2,1-2H3/t15-/m1/s1 |
| InChIKey | FSTNVZRYSWOEAY-OAHLLOKOSA-N |
| XLogP | 4.30 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.19 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |