C24H40N2O — CID 171287953
2,4-ditert-butyl-6-[(R)-cyclopentyl(piperazin-1-yl)methyl]phenol (PubChem CID 171287953) has the molecular formula C24H40N2O and a molecular weight of 372.60 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[(R)-cyclopentyl(piperazin-1-yl)methyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[(R)-cyclopentyl(piperazin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 171287953 |
| Molecular Formula | C24H40N2O |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 372.31 |
| IUPAC Name | 2,4-ditert-butyl-6-[(R)-cyclopentyl(piperazin-1-yl)methyl]phenol |
| SMILES | CC(C)(C)c1cc([C@@H](C2CCCC2)N2CCNCC2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H40N2O/c1-23(2,3)18-15-19(22(27)20(16-18)24(4,5)6)21(17-9-7-8-10-17)26-13-11-25-12-14-26/h15-17,21,25,27H,7-14H2,1-6H3/t21-/m1/s1 |
| InChIKey | WEQNYRNBVGVEFR-OAQYLSRUSA-N |
| XLogP | 5.12 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|