C17H26Cl2I2N2O — CID 171296536
2-[(R)-cyclohexyl(piperazin-1-yl)methyl]-4,6-diiodophenol;dihydrochloride (PubChem CID 171296536) has the molecular formula C17H26Cl2I2N2O and a molecular weight of 599.12 g/mol. Its IUPAC name is 2-[(R)-cyclohexyl(piperazin-1-yl)methyl]-4,6-diiodophenol;dihydrochloride.
| Compound Name | 2-[(R)-cyclohexyl(piperazin-1-yl)methyl]-4,6-diiodophenol;dihydrochloride |
|---|---|
| PubChem CID | 171296536 |
| Molecular Formula | C17H26Cl2I2N2O |
| Molecular Weight | 599.12 g/mol |
| Exact Mass | 597.95 |
| IUPAC Name | 2-[(R)-cyclohexyl(piperazin-1-yl)methyl]-4,6-diiodophenol;dihydrochloride |
| SMILES | Cl.Cl.Oc1c(I)cc(I)cc1[C@@H](C1CCCCC1)N1CCNCC1 |
| InChI | InChI=1S/C17H24I2N2O.2ClH/c18-13-10-14(17(22)15(19)11-13)16(12-4-2-1-3-5-12)21-8-6-20-7-9-21;;/h10-12,16,20,22H,1-9H2;2*1H/t16-;;/m1../s1 |
| InChIKey | IGOLIDZSEXLGFJ-GGMCWBHBSA-N |
| XLogP | 4.97 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.12 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|