C16H24FN3O — CID 171300852
2-amino-6-[(R)-cyclopentyl(piperazin-1-yl)methyl]-4-fluorophenol (PubChem CID 171300852) has the molecular formula C16H24FN3O and a molecular weight of 293.39 g/mol. Its IUPAC name is 2-amino-6-[(R)-cyclopentyl(piperazin-1-yl)methyl]-4-fluorophenol.
| Compound Name | 2-amino-6-[(R)-cyclopentyl(piperazin-1-yl)methyl]-4-fluorophenol |
|---|---|
| PubChem CID | 171300852 |
| Molecular Formula | C16H24FN3O |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 2-amino-6-[(R)-cyclopentyl(piperazin-1-yl)methyl]-4-fluorophenol |
| SMILES | Nc1cc(F)cc([C@@H](C2CCCC2)N2CCNCC2)c1O |
| InChI | InChI=1S/C16H24FN3O/c17-12-9-13(16(21)14(18)10-12)15(11-3-1-2-4-11)20-7-5-19-6-8-20/h9-11,15,19,21H,1-8,18H2/t15-/m1/s1 |
| InChIKey | GZVPKDQWTKKZKZ-OAHLLOKOSA-N |
| XLogP | 2.25 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|