C15H24Cl2FN3O — CID 171300851
2-amino-6-[(R)-cyclobutyl(piperazin-1-yl)methyl]-4-fluorophenol;dihydrochloride (PubChem CID 171300851) has the molecular formula C15H24Cl2FN3O and a molecular weight of 352.28 g/mol. Its IUPAC name is 2-amino-6-[(R)-cyclobutyl(piperazin-1-yl)methyl]-4-fluorophenol;dihydrochloride.
| Compound Name | 2-amino-6-[(R)-cyclobutyl(piperazin-1-yl)methyl]-4-fluorophenol;dihydrochloride |
|---|---|
| PubChem CID | 171300851 |
| Molecular Formula | C15H24Cl2FN3O |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-amino-6-[(R)-cyclobutyl(piperazin-1-yl)methyl]-4-fluorophenol;dihydrochloride |
| SMILES | Cl.Cl.Nc1cc(F)cc([C@@H](C2CCC2)N2CCNCC2)c1O |
| InChI | InChI=1S/C15H22FN3O.2ClH/c16-11-8-12(15(20)13(17)9-11)14(10-2-1-3-10)19-6-4-18-5-7-19;;/h8-10,14,18,20H,1-7,17H2;2*1H/t14-;;/m1../s1 |
| InChIKey | KZMKYVIHYCHOOJ-FMOMHUKBSA-N |
| XLogP | 2.70 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|