C16H25Cl2FN2 — CID 171277175
1-[(S)-cyclobutyl-(5-fluoro-2-methylphenyl)methyl]piperazine;dihydrochloride (PubChem CID 171277175) has the molecular formula C16H25Cl2FN2 and a molecular weight of 335.29 g/mol. Its IUPAC name is 1-[(S)-cyclobutyl-(5-fluoro-2-methylphenyl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-cyclobutyl-(5-fluoro-2-methylphenyl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171277175 |
| Molecular Formula | C16H25Cl2FN2 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-[(S)-cyclobutyl-(5-fluoro-2-methylphenyl)methyl]piperazine;dihydrochloride |
| SMILES | Cc1ccc(F)cc1[C@H](C1CCC1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H23FN2.2ClH/c1-12-5-6-14(17)11-15(12)16(13-3-2-4-13)19-9-7-18-8-10-19;;/h5-6,11,13,16,18H,2-4,7-10H2,1H3;2*1H/t16-;;/m0../s1 |
| InChIKey | WARQEJFFWLIWJT-SQKCAUCHSA-N |
| XLogP | 3.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |