C15H20F2N2 — CID 82304452
1-[cyclobutyl-(2,4-difluorophenyl)methyl]piperazine (PubChem CID 82304452) has the molecular formula C15H20F2N2 and a molecular weight of 266.33 g/mol. Its IUPAC name is 1-[cyclobutyl-(2,4-difluorophenyl)methyl]piperazine.
| Compound Name | 1-[cyclobutyl-(2,4-difluorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 82304452 |
| Molecular Formula | C15H20F2N2 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 1-[cyclobutyl-(2,4-difluorophenyl)methyl]piperazine |
| SMILES | Fc1ccc(C(C2CCC2)N2CCNCC2)c(F)c1 |
| InChI | InChI=1S/C15H20F2N2/c16-12-4-5-13(14(17)10-12)15(11-2-1-3-11)19-8-6-18-7-9-19/h4-5,10-11,15,18H,1-3,6-9H2 |
| InChIKey | BBDNBYOPHGOCCH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |