C16H23FN2O — CID 171179587
1-[(S)-cyclobutyl-(4-fluoro-2-methoxyphenyl)methyl]piperazine (PubChem CID 171179587) has the molecular formula C16H23FN2O and a molecular weight of 278.37 g/mol. Its IUPAC name is 1-[(S)-cyclobutyl-(4-fluoro-2-methoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(S)-cyclobutyl-(4-fluoro-2-methoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 171179587 |
| Molecular Formula | C16H23FN2O |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1-[(S)-cyclobutyl-(4-fluoro-2-methoxyphenyl)methyl]piperazine |
| SMILES | COc1cc(F)ccc1[C@H](C1CCC1)N1CCNCC1 |
| InChI | InChI=1S/C16H23FN2O/c1-20-15-11-13(17)5-6-14(15)16(12-3-2-4-12)19-9-7-18-8-10-19/h5-6,11-12,16,18H,2-4,7-10H2,1H3/t16-/m0/s1 |
| InChIKey | DGTCIYQRQKSXMK-INIZCTEOSA-N |
| XLogP | 2.58 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |