C17H24ClF3N2O — CID 171181597
1-[(S)-cyclobutyl-[2-methoxy-4-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride (PubChem CID 171181597) has the molecular formula C17H24ClF3N2O and a molecular weight of 364.84 g/mol. Its IUPAC name is 1-[(S)-cyclobutyl-[2-methoxy-4-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride.
| Compound Name | 1-[(S)-cyclobutyl-[2-methoxy-4-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171181597 |
| Molecular Formula | C17H24ClF3N2O |
| Molecular Weight | 364.84 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 1-[(S)-cyclobutyl-[2-methoxy-4-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride |
| SMILES | COc1cc(C(F)(F)F)ccc1[C@H](C1CCC1)N1CCNCC1.Cl |
| InChI | InChI=1S/C17H23F3N2O.ClH/c1-23-15-11-13(17(18,19)20)5-6-14(15)16(12-3-2-4-12)22-9-7-21-8-10-22;/h5-6,11-12,16,21H,2-4,7-10H2,1H3;1H/t16-;/m0./s1 |
| InChIKey | LMHBYKQUYVMNPY-NTISSMGPSA-N |
| XLogP | 3.88 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.84 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |