C19H28ClF3N2O — CID 171167987
1-[(S)-cyclohexyl-[2-methoxy-4-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride (PubChem CID 171167987) has the molecular formula C19H28ClF3N2O and a molecular weight of 392.89 g/mol. Its IUPAC name is 1-[(S)-cyclohexyl-[2-methoxy-4-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride.
| Compound Name | 1-[(S)-cyclohexyl-[2-methoxy-4-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171167987 |
| Molecular Formula | C19H28ClF3N2O |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 1-[(S)-cyclohexyl-[2-methoxy-4-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride |
| SMILES | COc1cc(C(F)(F)F)ccc1[C@H](C1CCCCC1)N1CCNCC1.Cl |
| InChI | InChI=1S/C19H27F3N2O.ClH/c1-25-17-13-15(19(20,21)22)7-8-16(17)18(14-5-3-2-4-6-14)24-11-9-23-10-12-24;/h7-8,13-14,18,23H,2-6,9-12H2,1H3;1H/t18-;/m0./s1 |
| InChIKey | MWRVNNDFBQWURW-FERBBOLQSA-N |
| XLogP | 4.66 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |